티스토리 뷰
Dev/JavaScript
20210216_JavaScript07 Array_quiz확인, String methods, Array methods, JOSN개념(HTTP, AJAX, XMLHttpRequest, JSON, XML)
라쿤 2021. 2. 17. 00:00JavaScript07
- JavaScript에 대해 공부하기 위해서 유튜브 '드림코딩by엘리' JavaScript 강의를 듣고 글을 쓰고 있다.(강의가 엄청 잘되 있으니 강의를 찾아보자!)
드림코딩 Array_quiz (강의 듣고서 확인)
- 일단, 강의 들으면서 놓친 Array API 위치를 확인함
- 가독성 좋게 메소드를 연달아 쓸수 있는 법을 확인함(리얼 꿀팁)
'use strict';
// Q1. make a string out of an array
console.log(' Q1. make a string out of an array')
{
const fruits = ['apple', 'banana', 'orange'];
console.log(fruits.toString()); // apple,banana,orange
console.log(fruits.join());
console.log(fruits.join('|'));
const k = false
console.log(typeof(k))
console.log(k.toString())
}
console.log('')
console.log('Q2. make an array out of a string')
// Q2. make an array out of a string
{
const fruits = '🍎,🥝,🍌,🍒'
console.log(fruits.split(','))
}
console.log('')
console.log('Q3. make this array look like this : [5, 4, 3, 2, 1]')
// Q3. make this array look like this : [5, 4, 3, 2, 1]
{
const array = [1, 2, 3, 4, 5];
console.log(array.reverse()); // reverse 접근만 해도 영향을 줌
console.log(array);
}
console.log('')
console.log('Q4. make new array without the first two elements (변형하면 안됨)')
// Q4. make new array without the first two elements (변형하면 안됨)
{
// 변형 하는 경우
const array = [1, 2, 3, 4, 5];
array.splice(0, 2)
console.log(array)
const array1 = [1, 2, 3, 4, 5];
array1.shift();
array1.shift();
console.log(array1);
// 변형 안하는 경우
const array3 = [1, 2, 3, 4, 5];
console.log(array3.slice(2))
console.log(array3.slice(2, 5)) // slice에서 end index는 배제됨
console.log(array3)
}
class Student {
constructor(name, age, enrolled, score) {
this.name = name;
this.age = age;
this.enrolled = enrolled;
this.score = score;
}
}
const students = [
new Student('A', 29, true, 45),
new Student('B', 28, false, 80),
new Student('C', 30, true, 90),
new Student('D', 40, false, 66),
new Student('E', 18, true, 88),
// new Student('F', 30, true, 90), // filter 확인용
];
console.log('')
console.log('Q5. find a student with the score 90')
// Q5. find a student with the score 90
{ // 내가 한거 // filter 은 모두 찾아서 Array 만듦
const scores = students.filter((Student) => Student.score === 90);
// console.log(scoreSt);
console.log(scores.pop());
}
{ // 강의에서 한거 // find는 처음 찾은 것을 return
const score90 = students.find((Student) => Student.score === 90);
console.log(score90);
}
console.log('')
console.log('Q6. make an array of enrolled students')
// Q6. make an array of enrolled students
{
const enrolled = students.filter((Student) => Student.enrolled == true);
console.log(enrolled);
// console.log(students); // 원본 지장 없음
}
console.log('')
console.log("Q7. make an array containing only the students' scores")
// Q7. make an array containing only the students' scores
// result should be : [45, 80, 90, 66, 88]
{
const scores = students.map((Student) => Student.score);
console.log(scores);
// console.log(students) // 원본 지장 없음
}
console.log('')
console.log("Q.8 check if there is a student with the score lower than 50")
// Q.8 check if there is a student with the score lower than 50
{ // 내가 한거
const check = students.some((Student) => Student.score < 50);
console.log(check);
}
{ // 강의에서 한거 (and로 or 연산하고 싶으면 조건 반대로 하고 출력값도 반대로)
const check = !students.every((Student) => Student.score >= 50);
console.log(check);
}
console.log('')
console.log("Q.9 compute students' average score")
// Q.9 compute students' average score
{ // 내가 한거 (map, reduce) reduce는 피보나치 수열임
const scores = students.map((Student) => Student.score);
const average = scores.reduce((prev, curr) => {
return (prev+curr)
}) / scores.length;
console.log(average);
}
{ // 내가한거 (map , for of loop)
const scores = students.map((Student) => Student.score);
let sum = 0;
for (let score of scores) {
sum += score;
};
const average = sum / scores.length
console.log(average)
}
{ // 강의 (reduce) // 첫번째 값 param 위치 조심! reduce(func, initial)
const average = students.reduce((prev, curr) => {
return (prev+curr.score)
}, 0) / (students.length)
console.log(average);
}
console.log('')
console.log('Q.10 make a string containing all the scores')
// Q.10 make a string containing all the scores
// result should be : '45, 80, 90, 66, 88'
{
const scores = students.map((Student) => Student.score);
console.log(scores.join())
}
// Bonus! do Q10 sorted in asending order
console.log('')
console.log('Bonus! do Q10 sorted in asending order')
// result should be : '45, 66, 80, 88, 90'
{ // 내가 한거 // 결과 음수 a가 앞으로감
// sort 만으로
const scores = students.map((Student) => Student.score);
const sort_scores = scores.sort((a, b) => {
return a - b;
});
console.log(sort_scores.join())
}
{ // sort, if 이용해서
const scores = students.map((Student) => Student.score);
const sort_scores = scores.sort((a, b) => {
if (a < b) {
return -1;
} else if (a > b) {
return +1;
} else {
return 0;
}
});
console.log(sort_scores.join())
}
{// 강의 (코드 가독성 굳굳 리얼)
const result = students
.map((student) => student.score)
.sort((a, b) => a - b)
.join();
console.log(result);
}
ES String method
- 강의에서 보니 정의된 위치를 찾아 갈때 어제는 symbol을 찾아 갔었던 것이다.. 다시보니 선택지가 두가지가 뜨는 것을 확인하고 다시
string method를 확인하고자 한다.
toString(): string;
: Array 때 처럼 똑같이 string형으로 바꾸어줌 (array, number, boolean 등 -> string)charAt(pos: number): string;
: string에서의 특정 index를 param로 받아 해당 index의 character를 반환함charCodeAt(index: number): number;
: 특정 index를 받아 해당 index의 string character의 유니코드 값을 반환함 (해당 인덱스에 character가 없으면 NaN을 반환)concat(...strings: string[]): string;
: 해당 string 끝에 붙일 string들을 받아 합쳐 합친 것을 반환함indexOf(searchString: string, position?: number): number;
: Array 때 처럼 찾고자하는 string 과 찾기 시작하는 index를 받아 시작하는 index로 부터 오르쪽으로 처음으로 발견한 인덱스를 반환lastIndexOf(searchString: string, position?: number): number;
: indesOf와 같이 string 과 찾기 시작하는 index를 받아 시작하는 index로 부터 왼쪽으로 처음으로 발견한 인덱스를 반환localeCompare(that: string): number;
: 로케일 상의 문자열 정렬 순서에서 특정 string을 받아 원래의 string과 비교하여 순서를 알게 숫자를 반환(음수:참조문자,비교문자 순 / 양수 : 비교문자,참조문자 순서 / 0 : 둘이 같음)replace(searchValue: string | RegExp, replaceValue: string): string;
: 해당 string에서 찾는 문자와 대체할 문자를 param으로 받아 대체함replace(searchValue: string | RegExp, replacer: (substring: string, ...args: any[]) => string): string;
: 해당 string에서 찾는 문자에 대체할 문자로 replacer라는 함수로 해당 string을 받아 활용해 return시킨 string으로 대체하게 할수 있다.slice(start?: number, end?: number): string;
: 해당 string의 부분을 반환 (start index 이상 end index 미만 까지 추출, end 없으면 마지막 index로 들어감) 항상 start index < end index 해야 함 만약 커버리면 ""를 반환, 음수 값도 음수 인덱스로 처리해서 인식split(separator: string | RegExp, limit?: number): string[];
: separator로 특정 문자를 받아서 separator 문자를 기준으로 잘라서 배열의 원소로 만들어 배열을 만들음 limit은 배열로 들어갈 원소의 개수 제한임substring(start: number, end?: number): string;
: slice와 똑같으나 start index > end index 여도 알아서 큰숫자를 end로 작은 숫자를 start로 인식함, 음수 인덱스는 무조건 0인덱스로 인식toLowerCase(): string;
: 소문자로 모두 변경toUpperCase(): string;
: 대문자로 모두 변경toLocaleLowerCase(locales?: string | string[]): string;
: 호스트의 현재 지정하고자 하는 로케일 옵션을 받아 소문자로 변경하고 로케일 값을 같이 가지고 있음toLocaleUpperCase(locales?: string | string[]): string;
: 위와 같은데 대문자로 변경trim(): string;
: 해당 string에서의 빈공백, 종결기호 등을 제거함 (데이터 정제시 좋다.)
interface String {
/** Returns a string representation of a string. */
toString(): string;
/**
* Returns the character at the specified index.
* @param pos The zero-based index of the desired character.
*/
charAt(pos: number): string;
/**
* Returns the Unicode value of the character at the specified location.
* @param index The zero-based index of the desired character. If there is no character at the specified index, NaN is returned.
*/
charCodeAt(index: number): number;
/**
* Returns a string that contains the concatenation of two or more strings.
* @param strings The strings to append to the end of the string.
*/
concat(...strings: string[]): string;
/**
* Returns the position of the first occurrence of a substring.
* @param searchString The substring to search for in the string
* @param position The index at which to begin searching the String object. If omitted, search starts at the beginning of the string.
*/
indexOf(searchString: string, position?: number): number;
/**
* Returns the last occurrence of a substring in the string.
* @param searchString The substring to search for.
* @param position The index at which to begin searching. If omitted, the search begins at the end of the string.
*/
lastIndexOf(searchString: string, position?: number): number;
/**
* Determines whether two strings are equivalent in the current locale.
* @param that String to compare to target string
*/
localeCompare(that: string): number;
/**
* Matches a string with a regular expression, and returns an array containing the results of that search.
* @param regexp A variable name or string literal containing the regular expression pattern and flags.
*/
match(regexp: string | RegExp): RegExpMatchArray | null;
/**
* Replaces text in a string, using a regular expression or search string.
* @param searchValue A string to search for.
* @param replaceValue A string containing the text to replace for every successful match of searchValue in this string.
*/
replace(searchValue: string | RegExp, replaceValue: string): string;
/**
* Replaces text in a string, using a regular expression or search string.
* @param searchValue A string to search for.
* @param replacer A function that returns the replacement text.
*/
replace(searchValue: string | RegExp, replacer: (substring: string, ...args: any[]) => string): string;
/**
* Finds the first substring match in a regular expression search.
* @param regexp The regular expression pattern and applicable flags.
*/
search(regexp: string | RegExp): number;
/**
* Returns a section of a string.
* @param start The index to the beginning of the specified portion of stringObj.
* @param end The index to the end of the specified portion of stringObj. The substring includes the characters up to, but not including, the character indicated by end.
* If this value is not specified, the substring continues to the end of stringObj.
*/
slice(start?: number, end?: number): string;
/**
* Split a string into substrings using the specified separator and return them as an array.
* @param separator A string that identifies character or characters to use in separating the string. If omitted, a single-element array containing the entire string is returned.
* @param limit A value used to limit the number of elements returned in the array.
*/
split(separator: string | RegExp, limit?: number): string[];
/**
* Returns the substring at the specified location within a String object.
* @param start The zero-based index number indicating the beginning of the substring.
* @param end Zero-based index number indicating the end of the substring. The substring includes the characters up to, but not including, the character indicated by end.
* If end is omitted, the characters from start through the end of the original string are returned.
*/
substring(start: number, end?: number): string;
/** Converts all the alphabetic characters in a string to lowercase. */
toLowerCase(): string;
/** Converts all alphabetic characters to lowercase, taking into account the host environment's current locale. */
toLocaleLowerCase(locales?: string | string[]): string;
/** Converts all the alphabetic characters in a string to uppercase. */
toUpperCase(): string;
/** Returns a string where all alphabetic characters have been converted to uppercase, taking into account the host environment's current locale. */
toLocaleUpperCase(locales?: string | string[]): string;
/** Removes the leading and trailing white space and line terminator characters from a string. */
trim(): string;
/** Returns the length of a String object. */
readonly length: number;
// IE extensions
/**
* Gets a substring beginning at the specified location and having the specified length.
* @param from The starting position of the desired substring. The index of the first character in the string is zero.
* @param length The number of characters to include in the returned substring.
*/
substr(from: number, length?: number): string;
/** Returns the primitive value of the specified object. */
valueOf(): string;
readonly [index: number]: string;
}
전글에서 놓쳤던 Array API
find,(predicate: (value: T, index: number, obj: T[]) => unknown, thisArg?: any): T | undefined;
: 해당 Array의 value, index, obj를 활용하는 predicate 함수 조건에 배열의 원소가 처음으로 true 값을 가지는 경우 그 원소의 값을 반환(즉, 찾아서 처음 값), 없으면 undifined 반환 (thisArg는 함수에서 사용할 this로 사용할 객체)findIndex,(predicate: (value: T, index: number, obj: T[]) => unknown, thisArg?: any): number;
: find처럼 쓰이는데 찾은 첫번째 원소의 index값 반환fill,(value: T, start?: number, end?: number): this;
: start index 이상 end index 미만 까지 value로 바꿔 채움(음수 인덱스 인식함)copyWithin,(target: number, start: number, end?: number): this;
: start index 이상 end index 미만 까지의 원소를 복사하여 target index부터 차례대로 덮어씀
interface Array<T> {
/**
* Returns the value of the first element in the array where predicate is true, and undefined
* otherwise.
* @param predicate find calls predicate once for each element of the array, in ascending
* order, until it finds one where predicate returns true. If such an element is found, find
* immediately returns that element value. Otherwise, find returns undefined.
* @param thisArg If provided, it will be used as the this value for each invocation of
* predicate. If it is not provided, undefined is used instead.
*/
find<S extends T>(predicate: (this: void, value: T, index: number, obj: T[]) => value is S, thisArg?: any): S | undefined;
find(predicate: (value: T, index: number, obj: T[]) => unknown, thisArg?: any): T | undefined;
/**
* Returns the index of the first element in the array where predicate is true, and -1
* otherwise.
* @param predicate find calls predicate once for each element of the array, in ascending
* order, until it finds one where predicate returns true. If such an element is found,
* findIndex immediately returns that element index. Otherwise, findIndex returns -1.
* @param thisArg If provided, it will be used as the this value for each invocation of
* predicate. If it is not provided, undefined is used instead.
*/
findIndex(predicate: (value: T, index: number, obj: T[]) => unknown, thisArg?: any): number;
/**
* Returns the this object after filling the section identified by start and end with value
* @param value value to fill array section with
* @param start index to start filling the array at. If start is negative, it is treated as
* length+start where length is the length of the array.
* @param end index to stop filling the array at. If end is negative, it is treated as
* length+end.
*/
fill(value: T, start?: number, end?: number): this;
/**
* Returns the this object after copying a section of the array identified by start and end
* to the same array starting at position target
* @param target If target is negative, it is treated as length+target where length is the
* length of the array.
* @param start If start is negative, it is treated as length+start. If end is negative, it
* is treated as length+end.
* @param end If not specified, length of the this object is used as its default value.
*/
copyWithin(target: number, start: number, end?: number): this;
}
JavaScript - JSON
HTTP : client(request) <-> server(response) 끼리 통신하는 법으로 protocal 중의 하나 (Hypertext Transfer Protocal)
- Hyptertext : web에서의 link, resource, docs, image, file 등
통신 방법 2가지
- fetch API
- XHR((XMLHttpRequest) 객체를 사용하는 방법
AJAX : HTTP를 이용한 문서들을 받아오는 방법으로 web page에서 동적으로 서버에게 XHR 객체 형태로 데이터를 주고 받을 수 있는 기술 (Asynchronous JavaScript And XML)
- XHR (XMLHttpRequest) : 브라우저 API에서 제공하는 오브젝트로 간단히 데이터를 서버에 요청하고 받아 올수 있음 ! XML 만 주고 받는게 아님(JSON, XML, HTML 그리고 일반 텍스트 형식 등을 포함한 다양한 포맷) !
XML : HTML처럼 markup 언어중에 하나로 과거에 주로 사용 (불필요한 태그가 많아, 가독성 떨어짐)
JSON (JavaScript Object Notation): Object {key : value} 이런 형식의 데이터 포맷
- 브라우저 또는 모바일에서 서버와 데이터를 주고 받을 경우 사용
- 서버 통신 하지 않을 경우 오브젝트를 file 시스템에 저장시에도 사용됨
- simple data interchange format
- lightweight text-based structure
- easy to read
- key-value pairs
- used for serialization and transmission of data between the network the network connection (데이터 직렬화 및 전송시 쓰임)
- independent programming language and platform (프로그램 언어에 상관 없이 같이 사용가능)
JSON 공부 방법
- object를 어떻게 serialize 하여 json(string)으로 변환 할지
- 반대로 json을 deserialize 하여 object로 변환 할지
interface JSON {
/**
* Converts a JavaScript Object Notation (JSON) string into an object.
* @param text A valid JSON string.
* @param reviver A function that transforms the results. This function is called for each member of the object.
* If a member contains nested objects, the nested objects are transformed before the parent object is.
*/
parse(text: string, reviver?: (this: any, key: string, value: any) => any): any;
/**
* Converts a JavaScript value to a JavaScript Object Notation (JSON) string.
* @param value A JavaScript value, usually an object or array, to be converted.
* @param replacer A function that transforms the results.
* @param space Adds indentation, white space, and line break characters to the return-value JSON text to make it easier to read.
*/
stringify(value: any, replacer?: (this: any, key: string, value: any) => any, space?: string | number): string;
/**
* Converts a JavaScript value to a JavaScript Object Notation (JSON) string.
* @param value A JavaScript value, usually an object or array, to be converted.
* @param replacer An array of strings and numbers that acts as an approved list for selecting the object properties that will be stringified.
* @param space Adds indentation, white space, and line break characters to the return-value JSON text to make it easier to read.
*/
stringify(value: any, replacer?: (number | string)[] | null, space?: string | number): string;
}
JSON 관련 사이트
JSON Diff
- 서버에서 받아온 자료가 첫번째와 두번째 자료가 어떻게 다른지 모를때 비교 가능
- 문제 debuging 시에 사용 가능
JSON Beautifier
- 서버에서 받아온 JSON 포멧이 망가지는 경우(코드를 그냥 줄글로 가져와 진경우) -> 포맷 형태로 만들어줌
JSON Parser
- json을 object형태로 확인 하고 싶다면 사용(눈으로 쉽게 확인 가능)
JSON Validator
- JSON syntax 확인 가능
'Dev > JavaScript' 카테고리의 다른 글
| 20210218_JavaScript09 async, await API, 강의완강 (0) | 2021.02.18 |
|---|---|
| 20210217_JavaScript08, async, Callback function, Promise Object (0) | 2021.02.17 |
| 20210215_JavaScript06 ES Array API(methods), String methods, 드림코딩Array_quiz (0) | 2021.02.16 |
| 20210213_JavaScript05 ,Object, Array (0) | 2021.02.14 |
| 20210212_JavaScript04 Class, Object, inheritance(상속), static(methods, proerties) (0) | 2021.02.12 |
공지사항
최근에 올라온 글
최근에 달린 댓글
- Total
- Today
- Yesterday
링크
TAG
- Class
- instagram CSS
- 트위터 클론
- Django
- github
- React
- hooks
- 그림판 만들기
- object
- 바닐라js
- async
- JavaScript
- nrc
- css
- Firebase
- todolist
- Python
- nodejs
- RUBY
- 오버라이딩
- NomadCoder
- html
- Git
- TypeScirpt
- project
- 생활코딩
- 드림코딩
- redux-toolkit
- 기능추가
| 일 | 월 | 화 | 수 | 목 | 금 | 토 |
|---|---|---|---|---|---|---|
| 1 | 2 | 3 | 4 | |||
| 5 | 6 | 7 | 8 | 9 | 10 | 11 |
| 12 | 13 | 14 | 15 | 16 | 17 | 18 |
| 19 | 20 | 21 | 22 | 23 | 24 | 25 |
| 26 | 27 | 28 | 29 | 30 |
글 보관함
